EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H31N |
| Net Charge | 0 |
| Average Mass | 273.464 |
| Monoisotopic Mass | 273.24565 |
| SMILES | [H][C@@]12C[C@@H]3CC[C@@]1(CC[C@]1([H])[C@H]4CCC[C@@]21CNC4)C[C@@H]3C |
| InChI | InChI=1S/C19H31N/c1-13-10-18-7-4-14(13)9-17(18)19-6-2-3-15(11-20-12-19)16(19)5-8-18/h13-17,20H,2-12H2,1H3/t13-,14-,15-,16+,17+,18+,19-/m0/s1 |
| InChIKey | WOBQEMZVRFCMHV-XABDGBQESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atidane (CHEBI:35919) is a diterpene alkaloid (CHEBI:23847) |
| atidane (CHEBI:35919) is a terpene alkaloid fundamental parent (CHEBI:38525) |
| Incoming Relation(s) |
| ajaconine (CHEBI:2523) has parent hydride atidane (CHEBI:35919) |
| IUPAC Name |
|---|
| atidane |