EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2 |
| Net Charge | 0 |
| Average Mass | 280.415 |
| Monoisotopic Mass | 280.19395 |
| SMILES | [H][C@]12N3CCCC14CCC1(CC4)Nc4ccccc4[C@@]12CC3 |
| InChI | InChI=1S/C19H24N2/c1-2-5-15-14(4-1)19-11-13-21-12-3-6-17(16(19)21)7-9-18(19,20-15)10-8-17/h1-2,4-5,16,20H,3,6-13H2/t16-,17?,18?,19+/m0/s1 |
| InChIKey | BIBZWCCWSCCFBB-MKCYZYCBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspidofractinine (CHEBI:35918) is a indole alkaloid (CHEBI:38958) |
| aspidofractinine (CHEBI:35918) is a indole alkaloid fundamental parent (CHEBI:38482) |
| IUPAC Name |
|---|
| aspidofractinine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1589859 | Beilstein |