EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O |
| Net Charge | 0 |
| Average Mass | 322.452 |
| Monoisotopic Mass | 322.20451 |
| SMILES | [H][C@@]12COC=C(CC)[C@]1([H])C[C@@]1([H])c3c(c4ccccc4n3C)C[C@]2([H])N1C |
| InChI | InChI=1S/C21H26N2O/c1-4-13-11-24-12-17-15(13)9-20-21-16(10-19(17)22(20)2)14-7-5-6-8-18(14)23(21)3/h5-8,11,15,17,19-20H,4,9-10,12H2,1-3H3/t15-,17+,19-,20-/m0/s1 |
| InChIKey | LSTHOTMJAIHSME-RKOGWWSCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alstophyllan (CHEBI:35917) is a indole alkaloid (CHEBI:38958) |
| alstophyllan (CHEBI:35917) is a indole alkaloid fundamental parent (CHEBI:38482) |
| IUPAC Name |
|---|
| alstophyllan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5410712 | Beilstein |