EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H14 |
| Net Charge | 0 |
| Average Mass | 302.376 |
| Monoisotopic Mass | 302.10955 |
| SMILES | c1ccc2c(c1)cc1ccc3cccc4c5ccccc5c2c1c34 |
| InChI | InChI=1S/C24H14/c1-2-8-18-16(6-1)14-17-13-12-15-7-5-11-20-19-9-3-4-10-21(19)24(18)23(17)22(15)20/h1-14H |
| InChIKey | JNTHRSHGARDABO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibenzo[a,l]pyrene (CHEBI:35861) has role human metabolite (CHEBI:77746) |
| dibenzo[a,l]pyrene (CHEBI:35861) has role mutagen (CHEBI:25435) |
| dibenzo[a,l]pyrene (CHEBI:35861) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| IUPAC Name |
|---|
| naphtho[1,2,3,4-pqr]tetraphene |
| Synonyms | Source |
|---|---|
| 1,2,3,4-Dibenzpyrene | ChemIDplus |
| 1,2,9,10-Dibenzopyrene | ChemIDplus |
| 1,2:3,4-Dibenzopyrene | ChemIDplus |
| 2,3:4,5-Dibenzopyrene | ChemIDplus |
| 4,5,6,7-Dibenzpyrene | ChemIDplus |
| Dibenzo[def,p]chrysene | NIST Chemistry WebBook |