EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12 |
| Net Charge | 0 |
| Average Mass | 192.261 |
| Monoisotopic Mass | 192.09390 |
| SMILES | Cc1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C15H12/c1-11-5-4-8-15-13(11)10-9-12-6-2-3-7-14(12)15/h2-10H,1H3 |
| InChIKey | DOWJXOHBNXRUOD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methylphenanthrene (CHEBI:35860) has role mutagen (CHEBI:25435) |
| 1-methylphenanthrene (CHEBI:35860) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 1-methylphenanthrene |
| Citations |
|---|