EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9ClN2O3S |
| Net Charge | 0 |
| Average Mass | 320.757 |
| Monoisotopic Mass | 320.00224 |
| SMILES | NC(=O)N1C(=O)/C(=C(\O)c2cccs2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H9ClN2O3S/c15-7-3-4-9-8(6-7)11(13(19)17(9)14(16)20)12(18)10-2-1-5-21-10/h1-6,18H,(H2,16,20)/b12-11- |
| InChIKey | LXIKEPCNDFVJKC-QXMHVHEDSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenidap (CHEBI:35847) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| tenidap (CHEBI:35847) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| tenidap (CHEBI:35847) is a indoles (CHEBI:24828) |
| tenidap (CHEBI:35847) is a organochlorine compound (CHEBI:36683) |
| tenidap (CHEBI:35847) is a thiophenes (CHEBI:26961) |
| tenidap (CHEBI:35847) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| (3Z)-5-chloro-3-[hydroxy(2-thienyl)methylidene]-2-oxo-2,3-dihydro-1H-indole-1-carboxamide |
| Synonyms | Source |
|---|---|
| Tenidap | ChemIDplus |
| (Z)-5-Chloro-3-(alpha-hydroxy-2-thenylidene)-2-oxo-1-indolinecarboxamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4728 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:120210-48-2 | ChemIDplus |