EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6AsNO6 |
| Net Charge | 0 |
| Average Mass | 263.037 |
| Monoisotopic Mass | 262.94111 |
| SMILES | O=[N+]([O-])c1cc([As](=O)(O)O)ccc1O |
| InChI | InChI=1S/C6H6AsNO6/c9-6-2-1-4(7(10,11)12)3-5(6)8(13)14/h1-3,9H,(H2,10,11,12) |
| InChIKey | XMVJITFPVVRMHC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | animal growth promotant Substances that are administered to farmed animals to improve productivity by promoting weight gain, increasing muscle mass, limiting fat deposition, reducing feed consumption, and reducing waste production. coccidiostat An agent useful in the treatment or prevention of coccidiosis in man or animals. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roxarsone (CHEBI:35817) has functional parent phenylarsonic acid (CHEBI:29851) |
| roxarsone (CHEBI:35817) has role agrochemical (CHEBI:33286) |
| roxarsone (CHEBI:35817) has role animal growth promotant (CHEBI:82655) |
| roxarsone (CHEBI:35817) has role antibacterial drug (CHEBI:36047) |
| roxarsone (CHEBI:35817) has role coccidiostat (CHEBI:35818) |
| roxarsone (CHEBI:35817) is a 2-nitrophenols (CHEBI:86421) |
| roxarsone (CHEBI:35817) is a organoarsonic acid (CHEBI:22638) |
| IUPAC Name |
|---|
| (4-hydroxy-3-nitrophenyl)arsonic acid |
| INNs | Source |
|---|---|
| roxarson | ChemIDplus |
| roxarsone | ChemIDplus |
| roxarsonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-nitro-1-hydroxybenzene-4-arsonic acid | ChemIDplus |
| 3-nitro-4-hydroxybenzenearsonic acid | ChemIDplus |
| 3-nitro-4-hydroxyphenylarsonic acid | ChemIDplus |
| 4-hydroxy-3-nitrobenzenearsonic acid | ChEBI |
| 4-hydroxy-3-nitrophenylarsonic acid | ChEBI |
| NSC-2101 | ChemIDplus |
| Brand Names | Source |
|---|---|
| 3-Nitro | ChEBI |
| Ren-O-Sal | ChemIDplus |
| Citations |
|---|