EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O2 |
| Net Charge | 0 |
| Average Mass | 170.252 |
| Monoisotopic Mass | 170.13068 |
| SMILES | CC1(C)O[C@]2(C)CC[C@H]1C[C@H]2O |
| InChI | InChI=1S/C10H18O2/c1-9(2)7-4-5-10(3,12-9)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8+,10+/m0/s1 |
| InChIKey | YVCUGZBVCHODNB-QXFUBDJGSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-endo-hydroxy-1,8-cineole (CHEBI:35811) is a cineole (CHEBI:23243) |
| IUPAC Name |
|---|
| (1R,4S,6R)-1,3,3-trimethyl-2-oxabicyclo[2.2.2]octan-6-ol |
| Synonym | Source |
|---|---|
| 6-exo-hydroxycineole | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-endo-hydroxy-1,8-cineole | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1422122 | Beilstein |