EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H6N2O |
| Net Charge | 0 |
| Average Mass | 74.083 |
| Monoisotopic Mass | 74.04801 |
| SMILES | CN(C)N=O |
| InChI | InChI=1S/C2H6N2O/c1-4(2)3-5/h1-2H3 |
| InChIKey | UMFJAHHVKNCGLG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-nitrosodimethylamine (CHEBI:35807) has role geroprotector (CHEBI:176497) |
| N-nitrosodimethylamine (CHEBI:35807) has role mutagen (CHEBI:25435) |
| N-nitrosodimethylamine (CHEBI:35807) is a nitrosamine (CHEBI:35803) |
| IUPAC Name |
|---|
| N-methyl-N-nitrosomethanamine |
| Synonyms | Source |
|---|---|
| 1,1-Dimethyl-2-oxohydrazine | NIST Chemistry WebBook |
| Dimethylnitrosamine | KEGG COMPOUND |
| Dimethylnitrosoamine | ChemIDplus |
| DMN | ChemIDplus |
| N,N-Dimethylnitrosamine | ChemIDplus |
| N-Nitrosodimethylamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1645 | PPDB |
| C14704 | KEGG COMPOUND |
| CPD-18996 | MetaCyc |
| FDB003496 | FooDB |
| HMDB0031419 | HMDB |
| N-Nitrosodimethylamine | Wikipedia |
| Citations |
|---|