EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O7 |
| Net Charge | -1 |
| Average Mass | 191.115 |
| Monoisotopic Mass | 191.01973 |
| SMILES | O=C([O-])CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-1 |
| InChIKey | KRKNYBCHXYNGOX-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dicarboxy-3-hydroxybutanoate (CHEBI:35806) is a citrate(1−) (CHEBI:35804) |
| 3,4-dicarboxy-3-hydroxybutanoate (CHEBI:35806) is conjugate acid of 2-(carboxymethyl)-2-hydroxysuccinate (CHEBI:35809) |
| 3,4-dicarboxy-3-hydroxybutanoate (CHEBI:35806) is conjugate acid of 3-carboxy-3-hydroxypentanedioate (CHEBI:35810) |
| 3,4-dicarboxy-3-hydroxybutanoate (CHEBI:35806) is tautomer of 3-carboxy-2-(carboxymethyl)-2-hydroxypropanoate (CHEBI:35802) |
| Incoming Relation(s) |
| 2-(carboxymethyl)-2-hydroxysuccinate (CHEBI:35809) is conjugate base of 3,4-dicarboxy-3-hydroxybutanoate (CHEBI:35806) |
| 3-carboxy-3-hydroxypentanedioate (CHEBI:35810) is conjugate base of 3,4-dicarboxy-3-hydroxybutanoate (CHEBI:35806) |
| 3-carboxy-2-(carboxymethyl)-2-hydroxypropanoate (CHEBI:35802) is tautomer of 3,4-dicarboxy-3-hydroxybutanoate (CHEBI:35806) |
| Synonym | Source |
|---|---|
| 3,4-dicarboxy-3-hydroxybutanoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:330279 | Gmelin |