EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N3O10 |
| Net Charge | -5 |
| Average Mass | 388.309 |
| Monoisotopic Mass | 388.10196 |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)[O-])CCN(CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C14H23N3O10/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27)/p-5 |
| InChIKey | QPCDCPDFJACHGM-UHFFFAOYSA-I |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentetate(5−) (CHEBI:35745) is a pentacarboxylic acid anion (CHEBI:35755) |
| pentetate(5−) (CHEBI:35745) is conjugate base of pentetate(4−) (CHEBI:35760) |
| Incoming Relation(s) |
| pentetate(4−) (CHEBI:35760) is conjugate acid of pentetate(5−) (CHEBI:35745) |
| IUPAC Name |
|---|
| 2,2',2'',2''',2''''-(ethane-1,2-diylnitrilo)pentaacetate |
| Synonyms | Source |
|---|---|
| diethylenetriaminepentaacetate | IUPAC |
| dtpa | IUPAC |
| dtpa5− | ChEBI |
| N,N-bis(2-(bis(carboxymethyl)amino)ethyl)glycine ion(5−) | ChemIDplus |
| N,N,N',N'',N''-diethylenetriaminepentaacetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:271646 | Gmelin |
| Beilstein:3759285 | Beilstein |
| CAS:14047-41-7 | ChemIDplus |
| CAS:14047-41-7 | NIST Chemistry WebBook |