EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:35739 - pentetic acid
| Formula | C14H23N3O10 |
| Net Charge | 0 |
| Average Mass | 393.349 |
| Monoisotopic Mass | 393.13834 |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H23N3O10/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | QPCDCPDFJACHGM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentetic acid (CHEBI:35739) has role copper chelator (CHEBI:166831) |
| pentetic acid (CHEBI:35739) is a pentacarboxylic acid (CHEBI:35743) |
| pentetic acid (CHEBI:35739) is conjugate acid of pentetate(1−) (CHEBI:35764) |
| Incoming Relation(s) |
| pentetate(1−) (CHEBI:35764) is conjugate base of pentetic acid (CHEBI:35739) |
| IUPAC Names |
|---|
| 2,2',2'',2''',2''''-(ethane-1,2-diylnitrilo)pentaacetic acid |
| N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine |
| Synonyms | Source |
|---|---|
| 1,1,4,7,7-diethylenetriaminepentaacetic acid | NIST Chemistry WebBook |
| [[(carboxymethyl)imino]bis(1,2-ethanediylnitrilo)tetraacetic acid] | IUPAC |
| Complexon V | ChemIDplus |
| diethylenetriamine-N,N,N',N'',N''-pentaacetic acid | NIST Chemistry WebBook |
| diethylenetriaminepentaacetic acid | NIST Chemistry WebBook |
| diethylenetriaminepentacetic acid | NIST Chemistry WebBook |