EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22FN3O3 |
| Net Charge | 0 |
| Average Mass | 359.401 |
| Monoisotopic Mass | 359.16452 |
| SMILES | CCN1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1 |
| InChI | InChI=1S/C19H22FN3O3/c1-2-21-5-7-22(8-6-21)17-10-16-13(9-15(17)20)18(24)14(19(25)26)11-23(16)12-3-4-12/h9-12H,2-8H2,1H3,(H,25,26) |
| InChIKey | SPFYMRJSYKOXGV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enrofloxacin (CHEBI:35720) has role antibacterial agent (CHEBI:33282) |
| enrofloxacin (CHEBI:35720) has role antimicrobial agent (CHEBI:33281) |
| enrofloxacin (CHEBI:35720) has role antineoplastic agent (CHEBI:35610) |
| enrofloxacin (CHEBI:35720) is a N-alkylpiperazine (CHEBI:46845) |
| enrofloxacin (CHEBI:35720) is a N-arylpiperazine (CHEBI:46848) |
| enrofloxacin (CHEBI:35720) is a cyclopropanes (CHEBI:51454) |
| enrofloxacin (CHEBI:35720) is a organofluorine compound (CHEBI:37143) |
| enrofloxacin (CHEBI:35720) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| enrofloxacin (CHEBI:35720) is a quinolone (CHEBI:23765) |
| IUPAC Name |
|---|
| 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| Baytril | ChemIDplus |
| Enrofloxacin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1017 | DrugCentral |
| 1762 | VSDB |
| D02473 | KEGG DRUG |
| Enrofloxacin | Wikipedia |
| HMDB0029861 | HMDB |
| KR20130080422 | Patent |
| LSM-3709 | LINCS |
| RU2491922 | Patent |
| US4659603 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5307824 | Reaxys |
| CAS:93106-60-6 | ChemIDplus |
| Citations |
|---|