EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | [H][C@@]1(C(=C)C)CC[C@@]2(C)O[C@@]2([H])C1 |
| InChI | InChI=1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | CCEFMUBVSUDRLG-KXUCPTDWSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-limonene 1β,2β-epoxide (CHEBI:35669) is a (4R)-limonene 1,2-epoxide (CHEBI:35672) |
| IUPAC Name |
|---|
| (1R,4R,6S)-1-methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane |
| Synonyms | Source |
|---|---|
| (1R,4R,6S)-4-isopropenyl-1-methyl-7-oxabicyclo[4.1.0]heptane | ChEBI |
| 1β,2β-epoxy-4βH-p-menth-8-ene | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:80941 | Beilstein |
| CAS:4680-24-4 | ChemIDplus |