EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N3O6 |
| Net Charge | 0 |
| Average Mass | 245.191 |
| Monoisotopic Mass | 245.06479 |
| SMILES | O=c1cnn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C8H11N3O6/c12-2-3-5(14)6(15)7(17-3)11-8(16)10-4(13)1-9-11/h1,3,5-7,12,14-15H,2H2,(H,10,13,16)/t3-,5-,6-,7-/m1/s1 |
| InChIKey | WYXSYVWAUAUWLD-SHUUEZRQSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-azauridine (CHEBI:35668) has role antimetabolite (CHEBI:35221) |
| 6-azauridine (CHEBI:35668) has role antineoplastic agent (CHEBI:35610) |
| 6-azauridine (CHEBI:35668) has role drug metabolite (CHEBI:49103) |
| 6-azauridine (CHEBI:35668) is a N-glycosyl-1,2,4-triazine (CHEBI:48018) |
| Incoming Relation(s) |
| 6-azauridine 5'-monophosphate (CHEBI:46319) has functional parent 6-azauridine (CHEBI:35668) |
| azaribine (CHEBI:88272) has functional parent 6-azauridine (CHEBI:35668) |
| IUPAC Name |
|---|
| 2-β-D-ribofuranosyl-1,2,4-triazine-3,5(2H,4H)-dione |
| Synonyms | Source |
|---|---|
| 2-beta-D-Ribofuranosyl-1,2,4-triazine-3,5(2H,4H)-dione | ChemIDplus |
| 2beta-D-Ribofuranosyl-as-triazine-3,5(2H,4H)-dione | ChemIDplus |
| 3,5-Dioxo-2,3,4,5-tetrahydro-1,2,4-triazine riboside | ChemIDplus |
| 6-Azauracil 1-riboside | ChemIDplus |
| 6-azauridine | ChEBI |
| Azauridine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 6-azauridine | UniProt |