EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N |
| Net Charge | 0 |
| Average Mass | 227.351 |
| Monoisotopic Mass | 227.16740 |
| SMILES | c1ccc2c(c1)CC[C@@]13CCCC[C@@]21CCN3 |
| InChI | InChI=1S/C16H21N/c1-2-6-14-13(5-1)7-10-16-9-4-3-8-15(14,16)11-12-17-16/h1-2,5-6,17H,3-4,7-12H2/t15-,16+/m1/s1 |
| InChIKey | RKWPQIQYRNOTMT-CVEARBPZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hasubanan (CHEBI:35647) is a isoquinoline alkaloid (CHEBI:24921) |
| hasubanan (CHEBI:35647) is a isoquinoline alkaloid fundamental parent (CHEBI:38515) |
| IUPAC Name |
|---|
| hasubanan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1573964 | Beilstein |