EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N |
| Net Charge | 0 |
| Average Mass | 227.351 |
| Monoisotopic Mass | 227.16740 |
| SMILES | c1ccc2c(c1)CCN1CC[C@@H]3CCCC[C@@]231 |
| InChI | InChI=1S/C16H21N/c1-2-7-15-13(5-1)8-11-17-12-9-14-6-3-4-10-16(14,15)17/h1-2,5,7,14H,3-4,6,8-12H2/t14-,16-/m0/s1 |
| InChIKey | PERYEAFHHZTAKL-HOCLYGCPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythrinan (CHEBI:35645) is a indolizidine alkaloid (CHEBI:38511) |
| erythrinan (CHEBI:35645) is a indolizine alkaloid fundamental parent (CHEBI:38513) |
| IUPAC Name |
|---|
| erythrinan |
| Synonym | Source |
|---|---|
| (4aS,13bS)-2,3,4,4a,5,6,8,9-octahydro-1H-indolo[7a,1-a]isoquinoline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1429226 | Beilstein |