EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25N |
| Net Charge | 0 |
| Average Mass | 219.372 |
| Monoisotopic Mass | 219.19870 |
| SMILES | [H][C@]12CCCN3CCC[C@]4([H])[C@@H](CCC[C@]314)CC2 |
| InChI | InChI=1S/C15H25N/c1-4-12-7-8-13-5-2-10-16-11-3-6-14(12)15(13,16)9-1/h12-14H,1-11H2/t12-,13+,14+,15-/m0/s1 |
| InChIKey | WEUSZYFSAZZUMH-YJNKXOJESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lycopodane (CHEBI:35639) is a quinolizidine alkaloid (CHEBI:26515) |
| lycopodane (CHEBI:35639) is a quinolizidine alkaloid fundamental parent (CHEBI:38526) |
| Incoming Relation(s) |
| lycopodine (CHEBI:6597) has parent hydride lycopodane (CHEBI:35639) |
| IUPAC Name |
|---|
| lycopodane |