EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClN2O3.2HCl |
| Net Charge | 0 |
| Average Mass | 461.817 |
| Monoisotopic Mass | 460.10873 |
| SMILES | Cl.Cl.O=C(O)COCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H25ClN2O3.2ClH/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26;;/h1-9,21H,10-16H2,(H,25,26);2*1H |
| InChIKey | PGLIUCLTXOYQMV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-allergic agent A drug used to treat allergic reactions. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cetirizine hydrochloride (CHEBI:3562) has role anti-allergic agent (CHEBI:50857) |
| Cetirizine hydrochloride (CHEBI:3562) has role nasal decongestant (CHEBI:77715) |
| Cetirizine hydrochloride (CHEBI:3562) has role ophthalmology drug (CHEBI:66981) |
| Cetirizine hydrochloride (CHEBI:3562) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| Cetirizine hydrochloride | KEGG COMPOUND |
| Cetrine | ChEMBL |
| NSC-759102 | ChEMBL |
| P 071 | ChEMBL |
| P-071 | ChEMBL |
| Zyrtec (TN) | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Allacan | ChEMBL |
| Allertek | ChEMBL |
| Becoallergy | ChEMBL |
| Cetec | ChEMBL |
| Cetirizine hydrochloride allergy | ChEMBL |
| Cetirizine hydrochloride component of zyrtec-d | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00664 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:83881-52-1 | KEGG COMPOUND |
| Citations |
|---|