EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClN2O3 |
| Net Charge | 0 |
| Average Mass | 388.895 |
| Monoisotopic Mass | 388.15537 |
| SMILES | O=C(O)COCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26) |
| InChIKey | ZKLPARSLTMPFCP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cetirizine (CHEBI:3561) has role anti-allergic agent (CHEBI:50857) |
| cetirizine (CHEBI:3561) has role environmental contaminant (CHEBI:78298) |
| cetirizine (CHEBI:3561) has role H1-receptor antagonist (CHEBI:37955) |
| cetirizine (CHEBI:3561) has role xenobiotic (CHEBI:35703) |
| cetirizine (CHEBI:3561) is a ether (CHEBI:25698) |
| cetirizine (CHEBI:3561) is a monocarboxylic acid (CHEBI:25384) |
| cetirizine (CHEBI:3561) is a monochlorobenzenes (CHEBI:83403) |
| cetirizine (CHEBI:3561) is a piperazines (CHEBI:26144) |
| IUPAC Name |
|---|
| (2-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}ethoxy)acetic acid |
| INNs | Source |
|---|---|
| cetirizine | KEGG DRUG |
| cetirizinum | ChemIDplus |
| cetirizina | ChemIDplus |
| cétirizine | ChEBI |
| Synonym | Source |
|---|---|
| Cetirizin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C07778 | KEGG COMPOUND |
| D07662 | KEGG DRUG |
| DB00341 | DrugBank |
| Cetirizine | Wikipedia |
| HMDB0005032 | HMDB |
| LSM-1544 | LINCS |
| 581 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7227333 | Reaxys |
| CAS:83881-51-0 | KEGG COMPOUND |
| CAS:83881-51-0 | ChemIDplus |
| Citations |
|---|