EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7N |
| Net Charge | 0 |
| Average Mass | 117.151 |
| Monoisotopic Mass | 117.05785 |
| SMILES | C1=Nc2ccccc2C1 |
| InChI | InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-4,6H,5H2 |
| InChIKey | RKJUIXBNRJVNHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3H-indole (CHEBI:35579) is a indole (CHEBI:35581) |
| 3H-indole (CHEBI:35579) is tautomer of 1H-indole (CHEBI:16881) |
| Incoming Relation(s) |
| 3-geranyl-3-[(Z)-2-isocyanovinyl]-3H-indole (CHEBI:140439) has functional parent 3H-indole (CHEBI:35579) |
| 1H-indole (CHEBI:16881) is tautomer of 3H-indole (CHEBI:35579) |
| IUPAC Name |
|---|
| 3H-indole |
| Registry Numbers | Sources |
|---|---|
| Beilstein:107688 | Beilstein |
| Gmelin:2037578 | Gmelin |
| CAS:271-26-1 | ChemIDplus |