EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO8 |
| Net Charge | 0 |
| Average Mass | 301.251 |
| Monoisotopic Mass | 301.07977 |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | IFBHRQDFSNCLOZ-YBXAARCKSA-N |
| Roles Classification |
|---|
| Biological Role: | affinity label An enzyme inhibitor, generally irreversible, that is similar in structure to a particular substrate for a specific enzyme. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitrophenyl-β-D-galactoside (CHEBI:355715) has role affinity label (CHEBI:60788) |
| 4-nitrophenyl-β-D-galactoside (CHEBI:355715) is a monosaccharide derivative (CHEBI:63367) |
| 4-nitrophenyl-β-D-galactoside (CHEBI:355715) is a β-D-galactoside (CHEBI:28034) |
| IUPAC Name |
|---|
| 4-nitrophenyl-β-D-galactopyranoside |
| Synonyms | Source |
|---|---|
| 1-O-(4-nitrophenyl)-β-D-galactopyranose | ChEBI |
| 1-O-(4-nitrophenyl)-β-D-galactose | ChEBI |
| 1-O-(p-nitrophenyl)-β-D-galactopyranose | ChEBI |
| 1-O-(p-nitrophenyl)-β-D-galactose | ChEBI |
| 1-O-[P-Nitrophenyl]-Beta-D-Galactopyranose | DrugBank |
| 1-O-[P-NITROPHENYL]-BETA-D-GALACTOPYRANOSE | PDBeChem |
| Citations |
|---|