EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H26O10 |
| Net Charge | 0 |
| Average Mass | 534.517 |
| Monoisotopic Mass | 534.15260 |
| SMILES | COc1c(C[C@@H](C)O)c2c3c(C[C@@H](C)O)c(OC)c(=O)c4c(O)cc5c(c6c(cc(O)c(c1=O)c62)OCO5)c43 |
| InChI | InChI=1S/C29H26O10/c1-10(30)5-12-18-19-13(6-11(2)31)29(37-4)27(35)21-15(33)8-17-23(25(19)21)22-16(38-9-39-17)7-14(32)20(24(18)22)26(34)28(12)36-3/h7-8,10-11,30-33H,5-6,9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | DGAZLNHJYDOWLG-GHMZBOCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cercospora (ncbitaxon:29002) | - | DOI (10.1016/0048-4059(78)90029-2) | |
| Cercospora kikuchii (ncbitaxon:84275) | - | DOI (10.1021/ja01578a038) | Isolated from dried mycelia. |
| Cercospora coffeicola (ncbitaxon:225974) | - | DOI (10.1111/jph.12802) | |
| Pseudocercosporella capsellae (ncbitaxon:1873268) | - | PubMed (30686233) |
| Roles Classification |
|---|
| Chemical Role: | reactive oxygen species generator Any entity used to generate reactive oxygen species. |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. phytotoxin Any toxin produced by a plant. |
| Application: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cercosporin (CHEBI:3556) has role fungal metabolite (CHEBI:76946) |
| cercosporin (CHEBI:3556) has role photosensitizing agent (CHEBI:47868) |
| cercosporin (CHEBI:3556) has role phytotoxin (CHEBI:38231) |
| cercosporin (CHEBI:3556) has role reactive oxygen species generator (CHEBI:70982) |
| cercosporin (CHEBI:3556) is a organic heterohexacyclic compound (CHEBI:51914) |
| cercosporin (CHEBI:3556) is a polyketide (CHEBI:26188) |
| cercosporin (CHEBI:3556) is a polyphenol (CHEBI:26195) |
| cercosporin (CHEBI:3556) is conjugate acid of cercosporin(2−) (CHEBI:146017) |
| Incoming Relation(s) |
| cercosporin(2−) (CHEBI:146017) is conjugate base of cercosporin (CHEBI:3556) |
| IUPAC Name |
|---|
| 5,12-dihydroxy-8,9-bis[(2R)-2-hydroxypropyl]-7,10-dimethoxyperylo[1,12-def][1,3]dioxepine-6,11-dione |
| Synonyms | Source |
|---|---|
| cercosporin | KEGG COMPOUND |
| (+)-cercosporin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:35082-49-6 | ChemIDplus |
| Citations |
|---|