EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H35N |
| Net Charge | 0 |
| Average Mass | 277.496 |
| Monoisotopic Mass | 277.27695 |
| SMILES | C1CCC(C(CC2CCCCN2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H35N/c1-3-9-16(10-4-1)19(17-11-5-2-6-12-17)15-18-13-7-8-14-20-18/h16-20H,1-15H2 |
| InChIKey | CYXKNKQEMFBLER-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perhexiline (CHEBI:35553) has role cardiovascular drug (CHEBI:35554) |
| perhexiline (CHEBI:35553) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 2-(2,2-dicyclohexylethyl)piperidine |
| INN | Source |
|---|---|
| perhexilina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Perhexilene | NIST Chemistry WebBook |
| Perhexiline | ChemIDplus |
| Citations |
|---|