EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7HF13O2 |
| Net Charge | 0 |
| Average Mass | 364.057 |
| Monoisotopic Mass | 363.97690 |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7HF13O2/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h(H,21,22) |
| InChIKey | ZWBAMYVPMDSJGQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluoroheptanoic acid (CHEBI:35547) has functional parent heptanoic acid (CHEBI:45571) |
| perfluoroheptanoic acid (CHEBI:35547) has functional parent perfluoroheptane (CHEBI:38847) |
| perfluoroheptanoic acid (CHEBI:35547) has role environmental contaminant (CHEBI:78298) |
| perfluoroheptanoic acid (CHEBI:35547) has role xenobiotic (CHEBI:35703) |
| perfluoroheptanoic acid (CHEBI:35547) is a fluoroalkanoic acid (CHEBI:35551) |
| IUPAC Name |
|---|
| tridecafluoroheptanoic acid |
| Synonyms | Source |
|---|---|
| perfluoro-n-heptanoic acid | ChemIDplus |
| tridecafluoro-1-heptanoic acid | ChemIDplus |
| perfluoroheptanoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Gmelin:589811 | Gmelin |
| Reaxys:1808210 | Reaxys |
| CAS:375-85-9 | ChemIDplus |
| Citations |
|---|