EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10HF19O2 |
| Net Charge | 0 |
| Average Mass | 514.078 |
| Monoisotopic Mass | 513.96732 |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10HF19O2/c11-2(12,1(30)31)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h(H,30,31) |
| InChIKey | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorodecanoic acid (CHEBI:35546) has functional parent decanoic acid (CHEBI:30813) |
| perfluorodecanoic acid (CHEBI:35546) has role environmental contaminant (CHEBI:78298) |
| perfluorodecanoic acid (CHEBI:35546) has role xenobiotic (CHEBI:35703) |
| perfluorodecanoic acid (CHEBI:35546) is a fluoroalkanoic acid (CHEBI:35551) |
| IUPAC Name |
|---|
| nonadecafluorodecanoic acid |
| Synonyms | Source |
|---|---|
| Ndfda | ChemIDplus |
| nonadecafluoro-n-decanoic acid | ChemIDplus |
| PFDA | ChemIDplus |
| perfluoro-n-decanoic acid | ChemIDplus |
| perfluorodecanoic acid | ChemIDplus |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid | NIST Chemistry WebBook |
| Citations |
|---|