EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3547 - cephradine
| Formula | C16H19N3O4S |
| Net Charge | 0 |
| Average Mass | 349.412 |
| Monoisotopic Mass | 349.10963 |
| SMILES | [H][C@]12SCC(C)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N)C1=CCC=CC1 |
| InChI | InChI=1S/C16H19N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1 |
| InChIKey | RDLPVSKMFDYCOR-UEKVPHQBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephradine (CHEBI:3547) has role antibacterial drug (CHEBI:36047) |
| cephradine (CHEBI:3547) is a cephalosporin (CHEBI:23066) |
| cephradine (CHEBI:3547) is a β-lactam antibiotic allergen (CHEBI:88225) |
| IUPAC Name |
|---|
| 7β-[(2R)-2-(cyclohexa-1,4-dienyl)-2-phenylacetamido]-3-methyl-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefradina | ChemIDplus |
| cefradine | ChEBI |
| cefradinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2R)-2-amino-2-cyclohexa-1,4-dien-1-ylacetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| (6R,7R)-7-((R)-2-Amino-2-(1,4-cyclohexadien-1-yl)acetamido)-3-methyl-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylic acid | ChemIDplus |
| 7-(D-2-Amino-2-(1,4-cyclohexadienyl)acetamide)desacetoxycephalosporanicacid | ChemIDplus |
| Anspor | KEGG DRUG |
| CED | KEGG DRUG |
| Cefradine | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Velosef | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 576 | DrugCentral |
| Cephradine | Wikipedia |
| D00264 | KEGG DRUG |
| DB01333 | DrugBank |
| HMDB0015428 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4211105 | Reaxys |
| CAS:38821-53-3 | KEGG COMPOUND |
| CAS:38821-53-3 | ChemIDplus |
| Citations |
|---|