EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H38N2O6 |
| Net Charge | 0 |
| Average Mass | 606.719 |
| Monoisotopic Mass | 606.27299 |
| SMILES | COc1ccc2cc1Oc1ccc(cc1)C[C@H]1c3c(cc4c(c3Oc3cc5c(cc3OC)CCN(C)[C@@H]5C2)OCO4)CCN1C |
| InChI | InChI=1S/C37H38N2O6/c1-38-13-11-24-18-31(41-4)33-20-27(24)28(38)16-23-7-10-30(40-3)32(17-23)44-26-8-5-22(6-9-26)15-29-35-25(12-14-39(29)2)19-34-36(37(35)45-33)43-21-42-34/h5-10,17-20,28-29H,11-16,21H2,1-4H3/t28-,29+/m1/s1 |
| InChIKey | YVPXVXANRNDGTA-WDYNHAJCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cepharanthine (CHEBI:3546) is a bisbenzylisoquinoline alkaloid (CHEBI:133004) |
| cepharanthine (CHEBI:3546) is a isoquinolines (CHEBI:24922) |
| IUPAC Name |
|---|
| (14S,27R)-22,33-dimethoxy-13,28-dimethyl-2,5,7,20-tetraoxa-13,28-diazaoctacyclo[25.6.2.216,19.13,10.121,25.04,8.014,39.031,35]nonatriaconta-1(33),3,8,10(39),16,18,21(36),22,24,31,34,37-dodecaene |
| Synonyms | Source |
|---|---|
| 6',12'-Dimethoxy-2,2'-dimethyl-6,7-(methylenebis(oxy))oxyacanthan | ChemIDplus |
| (+)-Cepharanthine | ChemIDplus |
| Cepharanthine | KEGG COMPOUND |
| Citations |
|---|