EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42O4 |
| Net Charge | 0 |
| Average Mass | 418.618 |
| Monoisotopic Mass | 418.30831 |
| SMILES | CC(C)CCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCC(C)C |
| InChI | InChI=1S/C26H42O4/c1-21(2)15-9-5-7-13-19-29-25(27)23-17-11-12-18-24(23)26(28)30-20-14-8-6-10-16-22(3)4/h11-12,17-18,21-22H,5-10,13-16,19-20H2,1-4H3 |
| InChIKey | HBGGXOJOCNVPFY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | plasticiser Any compound that is used as an additive to increase the plasticity or fluidity of a substance, particularly but not exclusively to synthetic polymers. endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diisononyl phthalate (CHEBI:35459) has role plasticiser (CHEBI:79056) |
| diisononyl phthalate (CHEBI:35459) is a diester (CHEBI:51307) |
| diisononyl phthalate (CHEBI:35459) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| bis(7-methyloctyl) benzene-1,2-dicarboxylate |
| Synonyms | Source |
|---|---|
| Enj 2065 | ChemIDplus |
| 1,2-Benzenedicarboxylic acid, diisononyl ester | ChemIDplus |
| Phthalic acid, diisononyl ester | ChemIDplus |
| Diisononyl phthalate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15221 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:28553-12-0 | ChemIDplus |
| CAS:28553-12-0 | KEGG COMPOUND |