EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Ca.2H2O4P |
| Net Charge | 0 |
| Average Mass | 234.050 |
| Monoisotopic Mass | 233.90073 |
| SMILES | O=P([O-])(O)O.O=P([O-])(O)O.[Ca+2] |
| InChI | InChI=1S/Ca.2H3O4P/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/q+2;;/p-2 |
| InChIKey | YYRMJZQKEFZXMX-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | nutrient A nutrient is a food component that an organism uses to survive and grow. |
| Application: | fertilizer A fertilizer is any substance that is added to soil or water to assist the growth of plants. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcium bis(dihydrogenphosphate) (CHEBI:35433) has role fertilizer (CHEBI:33287) |
| calcium bis(dihydrogenphosphate) (CHEBI:35433) is a calcium phosphate (CHEBI:77635) |
| IUPAC Name |
|---|
| calcium bis(dihydrogenphosphate) |
| Synonyms | Source |
|---|---|
| acid calcium phosphate | ChemIDplus |
| Ca(H2PO4)2 | IUPAC |
| Calcium biphosphate | KEGG COMPOUND |
| calcium bis(dihydrogen phosphate) | ChemIDplus |
| calcium dihydrogen orthophosphate | ChemIDplus |
| calcium superphosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C13556 | KEGG COMPOUND |
| Calcium_phosphate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:7758-23-8 | ChemIDplus |
| CAS:7758-23-8 | KEGG COMPOUND |