EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13I2NO4 |
| Net Charge | 0 |
| Average Mass | 525.080 |
| Monoisotopic Mass | 524.89340 |
| SMILES | NC(Cc1ccc(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C15H13I2NO4/c16-10-7-9(2-3-13(10)19)22-14-4-1-8(5-11(14)17)6-12(18)15(20)21/h1-5,7,12,19H,6,18H2,(H,20,21) |
| InChIKey | CPCJBZABTUOGNM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3'-diiodothyronine (CHEBI:35430) is a iodothyronine (CHEBI:24864) |
| Incoming Relation(s) |
| 3,3'-diiodo-L-thyronine (CHEBI:45698) is a 3,3'-diiodothyronine (CHEBI:35430) |
| IUPAC Name |
|---|
| 3,3'-diiodothyronine |
| Synonyms | Source |
|---|---|
| 2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3-iodophenyl]propanoic acid | ChEBI |
| 3,3'-T2 | ChemIDplus |
| O-(4-hydroxy-3-iodophenyl)-3-iodotyrosine | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2674477 | Beilstein |
| CAS:70-40-6 | ChemIDplus |