EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N4O9S |
| Net Charge | 0 |
| Average Mass | 446.438 |
| Monoisotopic Mass | 446.11075 |
| SMILES | [H][C@]12SCC(COC(N)=O)=C(C(=O)O)N1C(=O)[C@]2(NC(=O)CCC[C@@H](N)C(=O)O)OC |
| InChI | InChI=1S/C16H22N4O9S/c1-28-16(19-9(21)4-2-3-8(17)11(22)23)13(26)20-10(12(24)25)7(5-29-15(18)27)6-30-14(16)20/h8,14H,2-6,17H2,1H3,(H2,18,27)(H,19,21)(H,22,23)(H,24,25)/t8-,14-,16+/m1/s1 |
| InChIKey | LXWBXEWUSAABOA-VXSYNFHWSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephamycin C (CHEBI:3543) is a cephamycin (CHEBI:55429) |
| IUPAC Names |
|---|
| 7-[(5-amino-5-carboxypentanoyl)amino]-3-[(carbamoyloxy)methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 3-[(carbamoyloxy)methyl]-7α-methoxy-7β-[(5R)-5-amino-5-carboxypentanamido]-3,4-didehydrocepham-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| Cephamycin C | KEGG COMPOUND |
| antibiotic A-16886I | ChEBI |
| antibiotic WS-3442C | ChEBI |
| antibiotic A-16886B | ChEBI |
| antibiotic 842A | ChEBI |
| cephemimycin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C06566 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5406186 | Beilstein |
| CAS:38429-35-5 | ChemIDplus |
| CAS:38429-35-5 | KEGG COMPOUND |
| Citations |
|---|