EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N3O4S2 |
| Net Charge | 0 |
| Average Mass | 415.496 |
| Monoisotopic Mass | 415.06605 |
| SMILES | [H][C@]12SCC(C[n+]3ccccc3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C19H17N3O4S2/c23-14(9-13-5-4-8-27-13)20-15-17(24)22-16(19(25)26)12(11-28-18(15)22)10-21-6-2-1-3-7-21/h1-8,15,18H,9-11H2,(H-,20,23,25,26)/t15-,18-/m1/s1 |
| InChIKey | CZTQZXZIADLWOZ-CRAIPNDOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefaloridine (CHEBI:3537) has role antibacterial drug (CHEBI:36047) |
| cefaloridine (CHEBI:3537) is a cephalosporin (CHEBI:23066) |
| cefaloridine (CHEBI:3537) is a semisynthetic derivative (CHEBI:72588) |
| cefaloridine (CHEBI:3537) is a β-lactam antibiotic allergen (CHEBI:88225) |
| IUPAC Name |
|---|
| 3-(pyridinium-1-ylmethyl)-7β-[(2-thienylacetyl)amino]-3,4-didehydrocepham-4-carboxylate |
| INNs | Source |
|---|---|
| cefaloridine | KEGG DRUG |
| cefaloridina | ChemIDplus |
| cefaloridinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Cephaloridine | KEGG COMPOUND |
| 7-((2-Thienyl)acetamido)-3-(1-pyridylmethyl)cephalosporanic acid | ChemIDplus |
| Cefaloridin | ChemIDplus |
| Cefalorizin | ChemIDplus |
| Ceflorin | ChemIDplus |
| Cepaloridin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11754 | KEGG COMPOUND |
| D01075 | KEGG DRUG |
| Cephaloridine | Wikipedia |
| 573 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4166301 | Reaxys |
| CAS:50-59-9 | KEGG COMPOUND |
| CAS:50-59-9 | KEGG DRUG |
| CAS:50-59-9 | ChemIDplus |
| Citations |
|---|