EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O2 |
| Net Charge | 0 |
| Average Mass | 568.886 |
| Monoisotopic Mass | 568.42803 |
| SMILES | CC1=CC(O)CC(C)(C)C1/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1C(C)=CC(O)CC1(C)C |
| InChI | InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-26,35-38,41-42H,27-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+ |
| InChIKey | BIPAHAFBQLWRMC-DKLMTRRASA-N |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tunaxanthin (CHEBI:35326) has role animal metabolite (CHEBI:75767) |
| tunaxanthin (CHEBI:35326) has role marine metabolite (CHEBI:76507) |
| tunaxanthin (CHEBI:35326) is a carotenol (CHEBI:23045) |
| Incoming Relation(s) |
| lactucaxanthin (CHEBI:6357) is a tunaxanthin (CHEBI:35326) |
| IUPAC Name |
|---|
| ε,ε-carotene-3,3'-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2031575 | Reaxys |
| Citations |
|---|