EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O3 |
| Net Charge | 0 |
| Average Mass | 312.409 |
| Monoisotopic Mass | 312.17254 |
| SMILES | [H][C@]1(CCc2ccc(O)cc2)CCC[C@@]([H])(c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C20H24O3/c1-22-18-13-8-16(9-14-18)20-4-2-3-19(23-20)12-7-15-5-10-17(21)11-6-15/h5-6,8-11,13-14,19-21H,2-4,7,12H2,1H3/t19-,20+/m1/s1 |
| InChIKey | VKLGDLFSGNHXAV-UXHICEINSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Centrolobine (CHEBI:3532) is a diarylheptanoid (CHEBI:78802) |
| Synonym | Source |
|---|---|
| Centrolobine | KEGG COMPOUND |