EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O |
| Net Charge | 0 |
| Average Mass | 552.887 |
| Monoisotopic Mass | 552.43312 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/[C@]23O[C@@]2(C)CCCC3(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H56O/c1-31(19-13-21-33(3)24-25-36-35(5)23-15-27-37(36,6)7)17-11-12-18-32(2)20-14-22-34(4)26-30-40-38(8,9)28-16-29-39(40,10)41-40/h11-14,17-22,24-26,30H,15-16,23,27-29H2,1-10H3/b12-11+,19-13+,20-14+,25-24+,30-26+,31-17+,32-18+,33-21+,34-22+/t39-,40+/m0/s1 |
| InChIKey | RVCRIPILOFSMFG-MLLMWRMGSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5S,6R)-β-carotene 5,6-epoxide (CHEBI:35309) is a β-carotene 5,6-epoxide (CHEBI:27793) |
| IUPAC Name |
|---|
| (5S,6R)-5,6-epoxy-5,6-dihydro-β,β-carotene |
| Synonym | Source |
|---|---|
| (5S,6R)-β-carotene 5,6-epoxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1443891 | Beilstein |