EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O2 |
| Net Charge | 0 |
| Average Mass | 340.467 |
| Monoisotopic Mass | 340.21508 |
| SMILES | [H][C@]12Nc3ccccc3[C@@]1(C/C=C(\C)CCC=C(C)C)C[C@@H](C(=O)O)N2 |
| InChI | InChI=1S/C21H28N2O2/c1-14(2)7-6-8-15(3)11-12-21-13-18(19(24)25)23-20(21)22-17-10-5-4-9-16(17)21/h4-5,7,9-11,18,20,22-23H,6,8,12-13H2,1-3H3,(H,24,25)/b15-11+/t18-,20+,21+/m0/s1 |
| InChIKey | RHTZDVPVGDDBTM-SQSKXRONSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3R)-3-geranyl-2,3-dihydro-2,Nα-cyclo-L-tryptophan (CHEBI:35304) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| (2S,3R)-3-geranyl-2,3-dihydro-2,Nα-cyclo-L-tryptophan residue (CHEBI:141127) is substituent group from (2S,3R)-3-geranyl-2,3-dihydro-2,Nα-cyclo-L-tryptophan (CHEBI:35304) |
| IUPAC Name |
|---|
| (2S,3aR,8aS)-3a-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indole-2-carboxylic acid |
| Synonym | Source |
|---|---|
| 3'-geranyl-2',3'-dihydro-2',N2-cyclo-L-tryptophan | RESID |
| Manual Xrefs | Databases |
|---|---|
| AA0408 | RESID |