EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H14 |
| Net Charge | 0 |
| Average Mass | 278.354 |
| Monoisotopic Mass | 278.10955 |
| SMILES | c1ccc2c(c1)ccc1cc3c(ccc4ccccc43)cc12 |
| InChI | InChI=1S/C22H14/c1-3-7-19-15(5-1)9-11-17-14-22-18(13-21(17)19)12-10-16-6-2-4-8-20(16)22/h1-14H |
| InChIKey | LHRCREOYAASXPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibenz[a,h]anthracene (CHEBI:35299) has role mutagen (CHEBI:25435) |
| dibenz[a,h]anthracene (CHEBI:35299) is a ortho-fused polycyclic arene (CHEBI:35296) |
| Synonyms | Source |
|---|---|
| Dibenz[a,h]anthracene | KEGG COMPOUND |
| 1,2:5,6-Dibenzanthracene | KEGG COMPOUND |
| DBA | ChemIDplus |