EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4Cl2 |
| Net Charge | 0 |
| Average Mass | 147.004 |
| Monoisotopic Mass | 145.96901 |
| SMILES | Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H |
| InChIKey | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dichlorobenzene (CHEBI:35290) has role hepatotoxic agent (CHEBI:50908) |
| 1,2-dichlorobenzene (CHEBI:35290) has role metabolite (CHEBI:25212) |
| 1,2-dichlorobenzene (CHEBI:35290) is a dichlorobenzene (CHEBI:23697) |
| Incoming Relation(s) |
| 3,4-dichloroaniline (CHEBI:16767) has functional parent 1,2-dichlorobenzene (CHEBI:35290) |
| IUPAC Name |
|---|
| 1,2-dichlorobenzene |
| Synonyms | Source |
|---|---|
| 1,2-dichlorbenzene | NIST Chemistry WebBook |
| 1,2-Dichlorobenzene | KEGG COMPOUND |
| 2-dichlorobenzene | ChemIDplus |
| o-dichlorbenzene | NIST Chemistry WebBook |
| o-dichlorbenzol | NIST Chemistry WebBook |
| o-dichlorobenzol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 1,2-Dichlorobenzene | Wikipedia |
| C14328 | KEGG COMPOUND |
| O-DICHLOROBENZENE | MetaCyc |
| YAN | PDBeChem |
| Citations |
|---|