EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4Cl2 |
| Net Charge | 0 |
| Average Mass | 147.004 |
| Monoisotopic Mass | 145.96901 |
| SMILES | Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H |
| InChIKey | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dichlorobenzene (CHEBI:35290) has role hepatotoxic agent (CHEBI:50908) |
| 1,2-dichlorobenzene (CHEBI:35290) has role metabolite (CHEBI:25212) |
| 1,2-dichlorobenzene (CHEBI:35290) is a dichlorobenzene (CHEBI:23697) |
| Incoming Relation(s) |
| 3,4-dichloroaniline (CHEBI:16767) has functional parent 1,2-dichlorobenzene (CHEBI:35290) |
| IUPAC Name |
|---|
| 1,2-dichlorobenzene |
| Synonyms | Source |
|---|---|
| 2-dichlorobenzene | ChemIDplus |
| orthodichlorobenzol | NIST Chemistry WebBook |
| 1,2-dichlorbenzene | NIST Chemistry WebBook |
| o-dichlorobenzol | NIST Chemistry WebBook |
| ortho-dichlorobenzene | NIST Chemistry WebBook |
| o-dichlorbenzene | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C14328 | KEGG COMPOUND |
| O-DICHLOROBENZENE | MetaCyc |
| 1,2-Dichlorobenzene | Wikipedia |
| YAN | PDBeChem |
| Citations |
|---|