EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O4 |
| Net Charge | 0 |
| Average Mass | 600.884 |
| Monoisotopic Mass | 600.41786 |
| SMILES | CC(/C=C/C=C(C)/C=C/[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C40H56O4/c1-29(17-13-19-31(3)21-23-39-35(5,6)25-33(41)27-37(39,9)43-39)15-11-12-16-30(2)18-14-20-32(4)22-24-40-36(7,8)26-34(42)28-38(40,10)44-40/h11-24,33-34,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t33-,34-,37+,38+,39-,40-/m0/s1 |
| InChIKey | SZCBXWMUOPQSOX-WVJDLNGLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-violaxanthin (CHEBI:35288) has role food colouring (CHEBI:77182) |
| all-trans-violaxanthin (CHEBI:35288) is a violaxanthin (CHEBI:27295) |
| IUPAC Name |
|---|
| (3S,3'S,5R,5'R,6S,6'S)-5,5',6,6'-tetrahydro-5,6:5',6'-diepoxy-β,β-carotene-3,3'-diol |
| Synonyms | Source |
|---|---|
| Violaxanthin | KEGG COMPOUND |
| (3S,5R,6S,3'S,5'R,6'S)-5,6,5',6'-DIEPOXY-5,6,5',6'-TETRAHYDRO-BETA,BETA-CAROTENE-3,3'-DIOL | PDBeChem |
| all-trans-Violaxanthin | KEGG COMPOUND |
| (3S,3'S,5R,5'R,6S,6'S)-5,6:5',6'-diepoxy-5,5',6,6'-tetrahydro-β,β-carotene-3,3'-diol | ChemIDplus |
| E 161e | ChEBI |
| UniProt Name | Source |
|---|---|
| all-trans-violaxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C08614 | KEGG COMPOUND |
| XAT | PDBeChem |
| LMPR01070282 | LIPID MAPS |
| CPD1F-133 | MetaCyc |
| Violaxanthin | Wikipedia |
| HMDB0003101 | HMDB |
| C00003787 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:101269 | Reaxys |
| CAS:126-29-4 | KEGG COMPOUND |
| CAS:126-29-4 | ChemIDplus |
| Citations |
|---|