EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:35280 - L-proline betaine
| Formula | C7H13NO2 |
| Net Charge | 0 |
| Average Mass | 143.186 |
| Monoisotopic Mass | 143.09463 |
| SMILES | C[N+]1(C)CCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C7H13NO2/c1-8(2)5-3-4-6(8)7(9)10/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | CMUNUTVVOOHQPW-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leonurus japonicus (ncbitaxon:4138) | aerial part (BTO:0001658) | PubMed (24704554) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-proline betaine (CHEBI:35280) has functional parent L-prolinium (CHEBI:32864) |
| L-proline betaine (CHEBI:35280) has role food component (CHEBI:78295) |
| L-proline betaine (CHEBI:35280) has role human blood serum metabolite (CHEBI:85234) |
| L-proline betaine (CHEBI:35280) has role plant metabolite (CHEBI:76924) |
| L-proline betaine (CHEBI:35280) is a N-methyl-L-α-amino acid (CHEBI:21752) |
| L-proline betaine (CHEBI:35280) is a alkaloid (CHEBI:22315) |
| L-proline betaine (CHEBI:35280) is a amino-acid betaine (CHEBI:22860) |
| L-proline betaine (CHEBI:35280) is conjugate base of N,N-dimethyl-L-prolinium (CHEBI:44813) |
| L-proline betaine (CHEBI:35280) is enantiomer of D-proline betaine (CHEBI:134398) |
| Incoming Relation(s) |
| N,N-dimethyl-L-prolinium (CHEBI:44813) is conjugate acid of L-proline betaine (CHEBI:35280) |
| D-proline betaine (CHEBI:134398) is enantiomer of L-proline betaine (CHEBI:35280) |
| IUPAC Name |
|---|
| (2S)-1,1-dimethylpyrrolidinium-2-carboxylate |
| Synonyms | Source |
|---|---|
| Stachydrine | KEGG COMPOUND |
| proline betaine | ChEBI |
| N,N-dimethyl-L-proline | ChEBI |
| (S)-2-carboxylato-1,1-dimethylpyrrolidinium | ChemIDplus |
| UniProt Name | Source |
|---|---|
| L-proline betaine | UniProt |
| Citations |
|---|