EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8 |
| Net Charge | 0 |
| Average Mass | 68.119 |
| Monoisotopic Mass | 68.06260 |
| SMILES | C=CC(=C)C |
| InChI | InChI=1S/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3 |
| InChIKey | RRHGJUQNOFWUDK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoprene (CHEBI:35194) has role plant metabolite (CHEBI:76924) |
| isoprene (CHEBI:35194) is a alkadiene (CHEBI:33646) |
| isoprene (CHEBI:35194) is a hemiterpene (CHEBI:35188) |
| isoprene (CHEBI:35194) is a volatile organic compound (CHEBI:134179) |
| Incoming Relation(s) |
| 4-[(E)-{amino[(3-methylbut-2-en-1-yl)amino]methylidene}amino]butanoic acid (CHEBI:143814) has functional parent isoprene (CHEBI:35194) |
| IUPAC Name |
|---|
| 2-methylbuta-1,3-diene |
| Synonyms | Source |
|---|---|
| 2-methyl-1,3-butadiene | ChemIDplus |
| 2-Methyl-1,3-butadiene | KEGG COMPOUND |
| 2-methylbutadiene | NIST Chemistry WebBook |
| 2-methyldivinyl | ChemIDplus |
| CH2=C(CH3)CH=CH2 | IUPAC |
| isopentadiene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| isoprene | UniProt |
| Citations |
|---|