EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15N4O8S.Na |
| Net Charge | 0 |
| Average Mass | 446.373 |
| Monoisotopic Mass | 446.05083 |
| SMILES | [H][C@]12SCC(COC(N)=O)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1ccco1.[Na+] |
| InChI | InChI=1S/C16H16N4O8S.Na/c1-26-19-9(8-3-2-4-27-8)12(21)18-10-13(22)20-11(15(23)24)7(5-28-16(17)25)6-29-14(10)20;/h2-4,10,14H,5-6H2,1H3,(H2,17,25)(H,18,21)(H,23,24);/q;+1/p-1/b19-9-;/t10-,14-;/m1./s1 |
| InChIKey | URDOHUPGIOGTKV-JTBFTWTJSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cefuroxime sodium (CHEBI:3517) has role antiinfective agent (CHEBI:35441) |
| Cefuroxime sodium (CHEBI:3517) has role antimicrobial agent (CHEBI:33281) |
| Cefuroxime sodium (CHEBI:3517) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Cefuroxime sodium | KEGG COMPOUND |
| Sodium cefuroxime | ChEMBL |
| Brand Names | Source |
|---|---|
| Britacef | ChEMBL |
| Kefurox | ChEMBL |
| Zinacef | ChEMBL |
| Citations |
|---|