EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3516 - Cefuroxime axetil
| Formula | C20H22N4O10S |
| Net Charge | 0 |
| Average Mass | 510.481 |
| Monoisotopic Mass | 510.10566 |
| SMILES | [H][C@]12SCC(COC(N)=O)=C(C(=O)OC(C)OC(C)=O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1ccco1 |
| InChI | InChI=1S/C20H22N4O10S/c1-9(25)33-10(2)34-19(28)15-11(7-32-20(21)29)8-35-18-14(17(27)24(15)18)22-16(26)13(23-30-3)12-5-4-6-31-12/h4-6,10,14,18H,7-8H2,1-3H3,(H2,21,29)(H,22,26)/b23-13-/t10?,14-,18-/m1/s1 |
| InChIKey | KEJCWVGMRLCZQQ-YJBYXUATSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cefuroxime axetil (CHEBI:3516) is a cephalosporin (CHEBI:23066) |
| Synonyms | Source |
|---|---|
| Cefuroxime axetil | KEGG COMPOUND |
| Cefuroxime 1-acetoxyethyl ester | KEGG COMPOUND |
| cefurax | DrugCentral |
| ceftin | DrugCentral |
| cefazine | DrugCentral |
| altacef | DrugCentral |