EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N4O8S |
| Net Charge | 0 |
| Average Mass | 424.391 |
| Monoisotopic Mass | 424.06888 |
| SMILES | [H][C@]12SCC(COC(N)=O)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1ccco1 |
| InChI | InChI=1S/C16H16N4O8S/c1-26-19-9(8-3-2-4-27-8)12(21)18-10-13(22)20-11(15(23)24)7(5-28-16(17)25)6-29-14(10)20/h2-4,10,14H,5-6H2,1H3,(H2,17,25)(H,18,21)(H,23,24)/b19-9-/t10-,14-/m1/s1 |
| InChIKey | JFPVXVDWJQMJEE-IZRZKJBUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefuroxime (CHEBI:3515) has role drug allergen (CHEBI:88188) |
| cefuroxime (CHEBI:3515) is a 3-(carbamoyloxymethyl)cephalosporin (CHEBI:28084) |
| cefuroxime (CHEBI:3515) is a furans (CHEBI:24129) |
| cefuroxime (CHEBI:3515) is a oxime O-ether (CHEBI:36816) |
| IUPAC Name |
|---|
| 3-[(carbamoyloxy)methyl]-7β-[(2Z)-2-(furan-2-yl)-2-(methoxyimino)acetamido]-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefuroximum | ChemIDplus |
| cefuroxime | ChemIDplus |
| cefuroximo | ChemIDplus |
| Synonyms | Source |
|---|---|
| Cefuroxime | KEGG COMPOUND |
| (6R,7R)-3-[(carbamoyloxy)methyl]-7-{[(2Z)-2-furan-2-yl-2-(methoxyimino)acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Cefuroxim | ChemIDplus |
| Cephuroxime | ChemIDplus |
| Brand Names | Source |
|---|---|
| Sharox | ChemIDplus |
| Zinacef Danmark | ChemIDplus |
| Citations |
|---|