EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:3515 - cefuroxime
| Formula | C16H16N4O8S |
| Net Charge | 0 |
| Average Mass | 424.391 |
| Monoisotopic Mass | 424.06888 |
| SMILES | [H][C@]12SCC(COC(N)=O)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1ccco1 |
| InChI | InChI=1S/C16H16N4O8S/c1-26-19-9(8-3-2-4-27-8)12(21)18-10-13(22)20-11(15(23)24)7(5-28-16(17)25)6-29-14(10)20/h2-4,10,14H,5-6H2,1H3,(H2,17,25)(H,18,21)(H,23,24)/b19-9-/t10-,14-/m1/s1 |
| InChIKey | JFPVXVDWJQMJEE-IZRZKJBUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefuroxime (CHEBI:3515) has role antibacterial agent (CHEBI:33282) |
| cefuroxime (CHEBI:3515) has role antimicrobial agent (CHEBI:33281) |
| cefuroxime (CHEBI:3515) has role drug allergen (CHEBI:88188) |
| cefuroxime (CHEBI:3515) has role ophthalmology drug (CHEBI:66981) |
| cefuroxime (CHEBI:3515) is a 3-(carbamoyloxymethyl)cephalosporin (CHEBI:28084) |
| cefuroxime (CHEBI:3515) is a furans (CHEBI:24129) |
| cefuroxime (CHEBI:3515) is a oxime O-ether (CHEBI:36816) |
| IUPAC Name |
|---|
| 3-[(carbamoyloxy)methyl]-7β-[(2Z)-2-(furan-2-yl)-2-(methoxyimino)acetamido]-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefuroxima | WHO MedNet |
| cefuroxime | ChemIDplus |
| cefuroximo | ChemIDplus |
| cefuroximum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 640/359 | ChEMBL |
| (6R,7R)-3-[(carbamoyloxy)methyl]-7-{[(2Z)-2-furan-2-yl-2-(methoxyimino)acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Cefuroxim | ChemIDplus |
| Cefuroxime | KEGG COMPOUND |
| Cefuroximine | ChEMBL |
| Cephuroxime | ChemIDplus |
| Brand Names | Source |
|---|---|
| Sharox | ChemIDplus |
| Zinacef Danmark | ChemIDplus |
| Citations |
|---|