EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56 |
| Net Charge | 0 |
| Average Mass | 536.888 |
| Monoisotopic Mass | 536.43820 |
| SMILES | CC1=CCCC(C)(C)[C@@H]1/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-23,25-28,37H,15-16,24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+/t37-/m1/s1 |
| InChIKey | ANVAOWXLWRTKGA-QTRZAOAUSA-N |
| Roles Classification |
|---|
| Biological Roles: | provitamin A A provitamin that can be converted into vitamin A by enzymes from animal tissues. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6'S)-β,ε-carotene (CHEBI:35148) is a α-carotene (CHEBI:28425) |
| (6'S)-β,ε-carotene (CHEBI:35148) is enantiomer of (6'R)-β,ε-carotene (CHEBI:35147) |
| Incoming Relation(s) |
| (6'R)-β,ε-carotene (CHEBI:35147) is enantiomer of (6'S)-β,ε-carotene (CHEBI:35148) |
| IUPAC Name |
|---|
| (6'S)-β,ε-carotene |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2682045 | Beilstein |