EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O10P |
| Net Charge | 0 |
| Average Mass | 274.118 |
| Monoisotopic Mass | 274.00898 |
| SMILES | O=C(O)[C@H]1OC(OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11O10P/c7-1-2(8)4(5(10)11)15-6(3(1)9)16-17(12,13)14/h1-4,6-9H,(H,10,11)(H2,12,13,14)/t1-,2-,3+,4-,6?/m0/s1 |
| InChIKey | AIQDYKMWENWVQJ-AQKNRBDQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucuronic acid 1-phosphate (CHEBI:35145) has functional parent D-glucuronic acid (CHEBI:4178) |
| D-glucuronic acid 1-phosphate (CHEBI:35145) is a uronic acid phosphate (CHEBI:35139) |
| D-glucuronic acid 1-phosphate (CHEBI:35145) is conjugate acid of D-glucuronate 1-phosphate (CHEBI:28547) |
| Incoming Relation(s) |
| 1-phospho-α-D-glucuronic acid (CHEBI:16787) is a D-glucuronic acid 1-phosphate (CHEBI:35145) |
| D-glucuronate 1-phosphate (CHEBI:28547) is conjugate base of D-glucuronic acid 1-phosphate (CHEBI:35145) |
| IUPAC Name |
|---|
| 1-O-phosphono-D-glucopyranuronic acid |