EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O5 |
| Net Charge | 0 |
| Average Mass | 176.168 |
| Monoisotopic Mass | 176.06847 |
| SMILES | CC(C)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H12O5/c1-4(2)7(12,6(10)11)3-5(8)9/h4,12H,3H2,1-2H3,(H,8,9)(H,10,11)/t7-/m0/s1 |
| InChIKey | BITYXLXUCSKTJS-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-isopropylmalic acid (CHEBI:35128) is a 2-isopropylmalic acid (CHEBI:28635) |
| (2S)-2-isopropylmalic acid (CHEBI:35128) is conjugate acid of (2S)-2-isopropylmalate(2−) (CHEBI:1178) |
| Incoming Relation(s) |
| (2S)-2-isopropylmalate(2−) (CHEBI:1178) is conjugate base of (2S)-2-isopropylmalic acid (CHEBI:35128) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-2-(propan-2-yl)butanedioic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-hydroxy-2-isopropylsuccinic acid | ChEBI |
| (3S)-3-carboxy-3-hydroxy-4-methylpentanoic acid | ChEBI |
| (3S)-3-carboxy-3-hydroxyisocaproic acid | ChEBI |
| (S)-2-Hydroxy-2-(isopropyl)succinic acid | ChemIDplus |
| (2S)-2-Hydroxy-2-isopropylsuccinic acid | KEGG COMPOUND |
| 3-Carboxy-3-hydroxy-4-methylpentanoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02504 | KEGG COMPOUND |
| HMDB0000402 | HMDB |
| LMFA01170083 | LIPID MAPS |
| C00019690 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2085861 | Reaxys |
| CAS:49601-06-1 | ChemIDplus |