EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3MnO4 |
| Net Charge | 0 |
| Average Mass | 121.958 |
| Monoisotopic Mass | 121.94118 |
| SMILES | [H][O][Mn](=[O])([O][H])[O][H] |
| InChI | InChI=1S/Mn.3H2O.O/h;3*1H2;/q+3;;;;/p-3 |
| InChIKey | LVCIDEMNVARSJY-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypomanganic acid (CHEBI:35125) is a manganese oxoacid (CHEBI:35116) |
| hypomanganic acid (CHEBI:35125) is conjugate acid of dihydroxidodioxidomanganate(1−) (CHEBI:35126) |
| Incoming Relation(s) |
| dihydroxidodioxidomanganate(1−) (CHEBI:35126) is conjugate base of hypomanganic acid (CHEBI:35125) |
| IUPAC Names |
|---|
| trihydrogen(tetraoxidomanganate) |
| trihydroxidooxidomanganese |
| tetraoxomanganic(3−) acid |
| Synonyms | Source |
|---|---|
| [MnO(OH)3] | IUPAC |
| H3MnO4 | IUPAC |
| manganic(V) acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:277887 | Gmelin |