EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O5 |
| Net Charge | 0 |
| Average Mass | 176.168 |
| Monoisotopic Mass | 176.06847 |
| SMILES | CC(C)C(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C7H12O5/c1-3(2)4(6(9)10)5(8)7(11)12/h3-5,8H,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | RNQHMTFBUSSBJQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-isopropylmalic acid (CHEBI:35114) has functional parent succinic acid (CHEBI:15741) |
| 3-isopropylmalic acid (CHEBI:35114) is a 2-hydroxydicarboxylic acid (CHEBI:50263) |
| 3-isopropylmalic acid (CHEBI:35114) is a dicarboxylic fatty acid (CHEBI:189840) |
| 3-isopropylmalic acid (CHEBI:35114) is conjugate acid of 3-isopropylmalate(2−) (CHEBI:15592) |
| Incoming Relation(s) |
| (2R,3S)-3-isopropylmalic acid (CHEBI:43468) is a 3-isopropylmalic acid (CHEBI:35114) |
| 3-isopropylmalate(2−) (CHEBI:15592) is conjugate base of 3-isopropylmalic acid (CHEBI:35114) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(propan-2-yl)butanedioic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxy-3-isopropylsuccinic acid | ChEBI |
| 3-carboxy-2-hydroxy-4-methylpentanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB04279 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:16048-89-8 | ChEBI |
| Citations |
|---|